C26H32N4O4 — CID 42672098
2-methoxy-N-[4-[4-(4-methylbenzoyl)piperazin-1-yl]-3-(pyrrolidine-1-carbonyl)phenyl]acetamide (PubChem CID 42672098) has the molecular formula C26H32N4O4 and a molecular weight of 464.57 g/mol. Its IUPAC name is 2-methoxy-N-[4-[4-(4-methylbenzoyl)piperazin-1-yl]-3-(pyrrolidine-1-carbonyl)phenyl]acetamide.
| Compound Name | 2-methoxy-N-[4-[4-(4-methylbenzoyl)piperazin-1-yl]-3-(pyrrolidine-1-carbonyl)phenyl]acetamide |
|---|---|
| PubChem CID | 42672098 |
| Molecular Formula | C26H32N4O4 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | 2-methoxy-N-[4-[4-(4-methylbenzoyl)piperazin-1-yl]-3-(pyrrolidine-1-carbonyl)phenyl]acetamide |
| SMILES | COCC(=O)Nc1ccc(N2CCN(C(=O)c3ccc(C)cc3)CC2)c(C(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C26H32N4O4/c1-19-5-7-20(8-6-19)25(32)30-15-13-28(14-16-30)23-10-9-21(27-24(31)18-34-2)17-22(23)26(33)29-11-3-4-12-29/h5-10,17H,3-4,11-16,18H2,1-2H3,(H,27,31) |
| InChIKey | PFCYWSOQWSOEMR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|