C25H31N3O4 — CID 42755598
2,4-dimethoxy-N-[4-piperidin-1-yl-3-(pyrrolidine-1-carbonyl)phenyl]benzamide (PubChem CID 42755598) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is 2,4-dimethoxy-N-[4-piperidin-1-yl-3-(pyrrolidine-1-carbonyl)phenyl]benzamide.
| Compound Name | 2,4-dimethoxy-N-[4-piperidin-1-yl-3-(pyrrolidine-1-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 42755598 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 2,4-dimethoxy-N-[4-piperidin-1-yl-3-(pyrrolidine-1-carbonyl)phenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(N3CCCCC3)c(C(=O)N3CCCC3)c2)c(OC)c1 |
| InChI | InChI=1S/C25H31N3O4/c1-31-19-9-10-20(23(17-19)32-2)24(29)26-18-8-11-22(27-12-4-3-5-13-27)21(16-18)25(30)28-14-6-7-15-28/h8-11,16-17H,3-7,12-15H2,1-2H3,(H,26,29) |
| InChIKey | FMFZHHVATTYRMT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|