C24H31N3O4 — CID 4574277
N-butan-2-yl-5-[(2,4-dimethoxybenzoyl)amino]-2-pyrrolidin-1-ylbenzamide (PubChem CID 4574277) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is N-butan-2-yl-5-[(2,4-dimethoxybenzoyl)amino]-2-pyrrolidin-1-ylbenzamide.
| Compound Name | N-butan-2-yl-5-[(2,4-dimethoxybenzoyl)amino]-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 4574277 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | N-butan-2-yl-5-[(2,4-dimethoxybenzoyl)amino]-2-pyrrolidin-1-ylbenzamide |
| SMILES | CCC(C)NC(=O)c1cc(NC(=O)c2ccc(OC)cc2OC)ccc1N1CCCC1 |
| InChI | InChI=1S/C24H31N3O4/c1-5-16(2)25-24(29)20-14-17(8-11-21(20)27-12-6-7-13-27)26-23(28)19-10-9-18(30-3)15-22(19)31-4/h8-11,14-16H,5-7,12-13H2,1-4H3,(H,25,29)(H,26,28) |
| InChIKey | LTVPYFATJRXDPO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|