C27H35N5O — CID 42441139
N-[3-[4-[(1-ethylpyrazol-4-yl)methylamino]piperidin-1-yl]phenyl]-4-phenylbutanamide (PubChem CID 42441139) has the molecular formula C27H35N5O and a molecular weight of 445.61 g/mol. Its IUPAC name is N-[3-[4-[(1-ethylpyrazol-4-yl)methylamino]piperidin-1-yl]phenyl]-4-phenylbutanamide.
| Compound Name | N-[3-[4-[(1-ethylpyrazol-4-yl)methylamino]piperidin-1-yl]phenyl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 42441139 |
| Molecular Formula | C27H35N5O |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.28 |
| IUPAC Name | N-[3-[4-[(1-ethylpyrazol-4-yl)methylamino]piperidin-1-yl]phenyl]-4-phenylbutanamide |
| SMILES | CCn1cc(CNC2CCN(c3cccc(NC(=O)CCCc4ccccc4)c3)CC2)cn1 |
| InChI | InChI=1S/C27H35N5O/c1-2-32-21-23(20-29-32)19-28-24-14-16-31(17-15-24)26-12-7-11-25(18-26)30-27(33)13-6-10-22-8-4-3-5-9-22/h3-5,7-9,11-12,18,20-21,24,28H,2,6,10,13-17,19H2,1H3,(H,30,33) |
| InChIKey | DVIRGBGGICPHPK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |