C27H30FN3O2 — CID 42276922
N-[4-[4-[2-(3-fluorophenyl)ethylamino]piperidin-1-yl]phenyl]-2-phenoxyacetamide (PubChem CID 42276922) has the molecular formula C27H30FN3O2 and a molecular weight of 447.55 g/mol. Its IUPAC name is N-[4-[4-[2-(3-fluorophenyl)ethylamino]piperidin-1-yl]phenyl]-2-phenoxyacetamide.
| Compound Name | N-[4-[4-[2-(3-fluorophenyl)ethylamino]piperidin-1-yl]phenyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 42276922 |
| Molecular Formula | C27H30FN3O2 |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | N-[4-[4-[2-(3-fluorophenyl)ethylamino]piperidin-1-yl]phenyl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)Nc1ccc(N2CCC(NCCc3cccc(F)c3)CC2)cc1 |
| InChI | InChI=1S/C27H30FN3O2/c28-22-6-4-5-21(19-22)13-16-29-23-14-17-31(18-15-23)25-11-9-24(10-12-25)30-27(32)20-33-26-7-2-1-3-8-26/h1-12,19,23,29H,13-18,20H2,(H,30,32) |
| InChIKey | CTCZIWZISOIHKU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|