C25H29FN4OS — CID 26344146
N-[2-(3-fluorophenyl)ethyl]-2-[4-[4-(1,3-thiazol-2-ylmethylamino)piperidin-1-yl]phenyl]acetamide (PubChem CID 26344146) has the molecular formula C25H29FN4OS and a molecular weight of 452.60 g/mol. Its IUPAC name is N-[2-(3-fluorophenyl)ethyl]-2-[4-[4-(1,3-thiazol-2-ylmethylamino)piperidin-1-yl]phenyl]acetamide.
| Compound Name | N-[2-(3-fluorophenyl)ethyl]-2-[4-[4-(1,3-thiazol-2-ylmethylamino)piperidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 26344146 |
| Molecular Formula | C25H29FN4OS |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | N-[2-(3-fluorophenyl)ethyl]-2-[4-[4-(1,3-thiazol-2-ylmethylamino)piperidin-1-yl]phenyl]acetamide |
| SMILES | O=C(Cc1ccc(N2CCC(NCc3nccs3)CC2)cc1)NCCc1cccc(F)c1 |
| InChI | InChI=1S/C25H29FN4OS/c26-21-3-1-2-19(16-21)8-11-27-24(31)17-20-4-6-23(7-5-20)30-13-9-22(10-14-30)29-18-25-28-12-15-32-25/h1-7,12,15-16,22,29H,8-11,13-14,17-18H2,(H,27,31) |
| InChIKey | VVGNCIOLVAYCKQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|