C17H20FN3 — CID 43675369
N-[(3-fluorophenyl)methyl]-1-pyridin-2-ylpiperidin-4-amine (PubChem CID 43675369) has the molecular formula C17H20FN3 and a molecular weight of 285.37 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-1-pyridin-2-ylpiperidin-4-amine.
| Compound Name | N-[(3-fluorophenyl)methyl]-1-pyridin-2-ylpiperidin-4-amine |
|---|---|
| PubChem CID | 43675369 |
| Molecular Formula | C17H20FN3 |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-1-pyridin-2-ylpiperidin-4-amine |
| SMILES | Fc1cccc(CNC2CCN(c3ccccn3)CC2)c1 |
| InChI | InChI=1S/C17H20FN3/c18-15-5-3-4-14(12-15)13-20-16-7-10-21(11-8-16)17-6-1-2-9-19-17/h1-6,9,12,16,20H,7-8,10-11,13H2 |
| InChIKey | VWSGLDJBTOOOFW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |