C15H17Br2N3O — CID 62084118
N-[(4,5-dibromofuran-2-yl)methyl]-1-pyridin-2-ylpiperidin-4-amine (PubChem CID 62084118) has the molecular formula C15H17Br2N3O and a molecular weight of 415.13 g/mol. Its IUPAC name is N-[(4,5-dibromofuran-2-yl)methyl]-1-pyridin-2-ylpiperidin-4-amine.
| Compound Name | N-[(4,5-dibromofuran-2-yl)methyl]-1-pyridin-2-ylpiperidin-4-amine |
|---|---|
| PubChem CID | 62084118 |
| Molecular Formula | C15H17Br2N3O |
| Molecular Weight | 415.13 g/mol |
| Exact Mass | 412.97 |
| IUPAC Name | N-[(4,5-dibromofuran-2-yl)methyl]-1-pyridin-2-ylpiperidin-4-amine |
| SMILES | Brc1cc(CNC2CCN(c3ccccn3)CC2)oc1Br |
| InChI | InChI=1S/C15H17Br2N3O/c16-13-9-12(21-15(13)17)10-19-11-4-7-20(8-5-11)14-3-1-2-6-18-14/h1-3,6,9,11,19H,4-5,7-8,10H2 |
| InChIKey | LUZAFPDWCNIIJP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.13 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |