C30H36FN5O — CID 74499135
N-benzyl-2-[4-[4-[[3-(4-fluorophenyl)pyrazolidin-4-yl]methylamino]piperidin-1-yl]phenyl]acetamide (PubChem CID 74499135) has the molecular formula C30H36FN5O and a molecular weight of 501.65 g/mol. Its IUPAC name is N-benzyl-2-[4-[4-[[3-(4-fluorophenyl)pyrazolidin-4-yl]methylamino]piperidin-1-yl]phenyl]acetamide.
| Compound Name | N-benzyl-2-[4-[4-[[3-(4-fluorophenyl)pyrazolidin-4-yl]methylamino]piperidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 74499135 |
| Molecular Formula | C30H36FN5O |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.29 |
| IUPAC Name | N-benzyl-2-[4-[4-[[3-(4-fluorophenyl)pyrazolidin-4-yl]methylamino]piperidin-1-yl]phenyl]acetamide |
| SMILES | O=C(Cc1ccc(N2CCC(NCC3CNNC3c3ccc(F)cc3)CC2)cc1)NCc1ccccc1 |
| InChI | InChI=1S/C30H36FN5O/c31-26-10-8-24(9-11-26)30-25(21-34-35-30)20-32-27-14-16-36(17-15-27)28-12-6-22(7-13-28)18-29(37)33-19-23-4-2-1-3-5-23/h1-13,25,27,30,32,34-35H,14-21H2,(H,33,37) |
| InChIKey | MZDFZTPYFMMLNH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 68.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|