C30H35N3O3 — CID 26328924
N-benzyl-2-[4-[4-[2-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]ethylamino]piperidin-1-yl]phenyl]acetamide (PubChem CID 26328924) has the molecular formula C30H35N3O3 and a molecular weight of 485.63 g/mol. Its IUPAC name is N-benzyl-2-[4-[4-[2-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]ethylamino]piperidin-1-yl]phenyl]acetamide.
| Compound Name | N-benzyl-2-[4-[4-[2-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]ethylamino]piperidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 26328924 |
| Molecular Formula | C30H35N3O3 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | N-benzyl-2-[4-[4-[2-[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]ethylamino]piperidin-1-yl]phenyl]acetamide |
| SMILES | O=C(Cc1ccc(N2CCC(NCC[C@H]3COc4ccccc4O3)CC2)cc1)NCc1ccccc1 |
| InChI | InChI=1S/C30H35N3O3/c34-30(32-21-24-6-2-1-3-7-24)20-23-10-12-26(13-11-23)33-18-15-25(16-19-33)31-17-14-27-22-35-28-8-4-5-9-29(28)36-27/h1-13,25,27,31H,14-22H2,(H,32,34)/t27-/m0/s1 |
| InChIKey | AZNRFEFIDSOGLM-MHZLTWQESA-N |
| XLogP | 4.33 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|