C27H33N3OS — CID 45208129
N-benzyl-2-[4-[4-(1-thiophen-3-ylpropan-2-ylamino)piperidin-1-yl]phenyl]acetamide (PubChem CID 45208129) has the molecular formula C27H33N3OS and a molecular weight of 447.65 g/mol. Its IUPAC name is N-benzyl-2-[4-[4-(1-thiophen-3-ylpropan-2-ylamino)piperidin-1-yl]phenyl]acetamide.
| Compound Name | N-benzyl-2-[4-[4-(1-thiophen-3-ylpropan-2-ylamino)piperidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 45208129 |
| Molecular Formula | C27H33N3OS |
| Molecular Weight | 447.65 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | N-benzyl-2-[4-[4-(1-thiophen-3-ylpropan-2-ylamino)piperidin-1-yl]phenyl]acetamide |
| SMILES | CC(Cc1ccsc1)NC1CCN(c2ccc(CC(=O)NCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C27H33N3OS/c1-21(17-24-13-16-32-20-24)29-25-11-14-30(15-12-25)26-9-7-22(8-10-26)18-27(31)28-19-23-5-3-2-4-6-23/h2-10,13,16,20-21,25,29H,11-12,14-15,17-19H2,1H3,(H,28,31) |
| InChIKey | OZBZOYBGXHJFHY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.65 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|