C27H33N3OS — CID 42246985
2,4-dimethyl-N-[4-[4-[[(2S)-1-thiophen-3-ylpropan-2-yl]amino]piperidin-1-yl]phenyl]benzamide (PubChem CID 42246985) has the molecular formula C27H33N3OS and a molecular weight of 447.65 g/mol. Its IUPAC name is 2,4-dimethyl-N-[4-[4-[[(2S)-1-thiophen-3-ylpropan-2-yl]amino]piperidin-1-yl]phenyl]benzamide.
| Compound Name | 2,4-dimethyl-N-[4-[4-[[(2S)-1-thiophen-3-ylpropan-2-yl]amino]piperidin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 42246985 |
| Molecular Formula | C27H33N3OS |
| Molecular Weight | 447.65 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 2,4-dimethyl-N-[4-[4-[[(2S)-1-thiophen-3-ylpropan-2-yl]amino]piperidin-1-yl]phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(N3CCC(N[C@@H](C)Cc4ccsc4)CC3)cc2)c(C)c1 |
| InChI | InChI=1S/C27H33N3OS/c1-19-4-9-26(20(2)16-19)27(31)29-23-5-7-25(8-6-23)30-13-10-24(11-14-30)28-21(3)17-22-12-15-32-18-22/h4-9,12,15-16,18,21,24,28H,10-11,13-14,17H2,1-3H3,(H,29,31)/t21-/m0/s1 |
| InChIKey | PLNYJDYFKZJGSN-NRFANRHFSA-N |
| XLogP | 5.81 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.65 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|