C26H33N5O — CID 42405693
2,4-dimethyl-N-[4-[4-[methyl-[(1-methylimidazol-2-yl)methyl]amino]piperidin-1-yl]phenyl]benzamide (PubChem CID 42405693) has the molecular formula C26H33N5O and a molecular weight of 431.58 g/mol. Its IUPAC name is 2,4-dimethyl-N-[4-[4-[methyl-[(1-methylimidazol-2-yl)methyl]amino]piperidin-1-yl]phenyl]benzamide.
| Compound Name | 2,4-dimethyl-N-[4-[4-[methyl-[(1-methylimidazol-2-yl)methyl]amino]piperidin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 42405693 |
| Molecular Formula | C26H33N5O |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | 2,4-dimethyl-N-[4-[4-[methyl-[(1-methylimidazol-2-yl)methyl]amino]piperidin-1-yl]phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(N3CCC(N(C)Cc4nccn4C)CC3)cc2)c(C)c1 |
| InChI | InChI=1S/C26H33N5O/c1-19-5-10-24(20(2)17-19)26(32)28-21-6-8-23(9-7-21)31-14-11-22(12-15-31)30(4)18-25-27-13-16-29(25)3/h5-10,13,16-17,22H,11-12,14-15,18H2,1-4H3,(H,28,32) |
| InChIKey | GAMVKKOAVHQPAU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|