C26H31N3O2 — CID 42277195
N-[4-[4-[2-(furan-2-yl)ethylamino]piperidin-1-yl]phenyl]-2,4-dimethylbenzamide (PubChem CID 42277195) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is N-[4-[4-[2-(furan-2-yl)ethylamino]piperidin-1-yl]phenyl]-2,4-dimethylbenzamide.
| Compound Name | N-[4-[4-[2-(furan-2-yl)ethylamino]piperidin-1-yl]phenyl]-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 42277195 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | N-[4-[4-[2-(furan-2-yl)ethylamino]piperidin-1-yl]phenyl]-2,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(N3CCC(NCCc4ccco4)CC3)cc2)c(C)c1 |
| InChI | InChI=1S/C26H31N3O2/c1-19-5-10-25(20(2)18-19)26(30)28-22-6-8-23(9-7-22)29-15-12-21(13-16-29)27-14-11-24-4-3-17-31-24/h3-10,17-18,21,27H,11-16H2,1-2H3,(H,28,30) |
| InChIKey | KRHYEXGGYRARSO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|