C25H33N3O2 — CID 118758657
2,4-dimethyl-N-[4-[4-(oxolan-2-ylmethylamino)piperidin-1-yl]phenyl]benzamide (PubChem CID 118758657) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 2,4-dimethyl-N-[4-[4-(oxolan-2-ylmethylamino)piperidin-1-yl]phenyl]benzamide.
| Compound Name | 2,4-dimethyl-N-[4-[4-(oxolan-2-ylmethylamino)piperidin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 118758657 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | 2,4-dimethyl-N-[4-[4-(oxolan-2-ylmethylamino)piperidin-1-yl]phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(N3CCC(NCC4CCCO4)CC3)cc2)c(C)c1 |
| InChI | InChI=1S/C25H33N3O2/c1-18-5-10-24(19(2)16-18)25(29)27-21-6-8-22(9-7-21)28-13-11-20(12-14-28)26-17-23-4-3-15-30-23/h5-10,16,20,23,26H,3-4,11-15,17H2,1-2H3,(H,27,29) |
| InChIKey | KWYCDBYTHUVISE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|