C20H23ClN2O — CID 21229733
2-chloro-4-methyl-N-[4-(4-methylpiperidin-1-yl)phenyl]benzamide (PubChem CID 21229733) has the molecular formula C20H23ClN2O and a molecular weight of 342.87 g/mol. Its IUPAC name is 2-chloro-4-methyl-N-[4-(4-methylpiperidin-1-yl)phenyl]benzamide.
| Compound Name | 2-chloro-4-methyl-N-[4-(4-methylpiperidin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 21229733 |
| Molecular Formula | C20H23ClN2O |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 2-chloro-4-methyl-N-[4-(4-methylpiperidin-1-yl)phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(N3CCC(C)CC3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C20H23ClN2O/c1-14-9-11-23(12-10-14)17-6-4-16(5-7-17)22-20(24)18-8-3-15(2)13-19(18)21/h3-8,13-14H,9-12H2,1-2H3,(H,22,24) |
| InChIKey | AOTYOWVKWMKTTD-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|