C24H33N3O3 — CID 26341946
N-[4-[4-[[(2S)-2,3-dihydroxypropyl]-methylamino]piperidin-1-yl]phenyl]-2,4-dimethylbenzamide (PubChem CID 26341946) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is N-[4-[4-[[(2S)-2,3-dihydroxypropyl]-methylamino]piperidin-1-yl]phenyl]-2,4-dimethylbenzamide.
| Compound Name | N-[4-[4-[[(2S)-2,3-dihydroxypropyl]-methylamino]piperidin-1-yl]phenyl]-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 26341946 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | N-[4-[4-[[(2S)-2,3-dihydroxypropyl]-methylamino]piperidin-1-yl]phenyl]-2,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(N3CCC(N(C)C[C@H](O)CO)CC3)cc2)c(C)c1 |
| InChI | InChI=1S/C24H33N3O3/c1-17-4-9-23(18(2)14-17)24(30)25-19-5-7-21(8-6-19)27-12-10-20(11-13-27)26(3)15-22(29)16-28/h4-9,14,20,22,28-29H,10-13,15-16H2,1-3H3,(H,25,30)/t22-/m0/s1 |
| InChIKey | RGWMFFGLPVEENO-QFIPXVFZSA-N |
| XLogP | 2.81 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|