C29H35N3O3 — CID 42451584
N-[4-[4-[(2,4-dimethoxyphenyl)methylamino]piperidin-1-yl]phenyl]-2,4-dimethylbenzamide (PubChem CID 42451584) has the molecular formula C29H35N3O3 and a molecular weight of 473.62 g/mol. Its IUPAC name is N-[4-[4-[(2,4-dimethoxyphenyl)methylamino]piperidin-1-yl]phenyl]-2,4-dimethylbenzamide.
| Compound Name | N-[4-[4-[(2,4-dimethoxyphenyl)methylamino]piperidin-1-yl]phenyl]-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 42451584 |
| Molecular Formula | C29H35N3O3 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | N-[4-[4-[(2,4-dimethoxyphenyl)methylamino]piperidin-1-yl]phenyl]-2,4-dimethylbenzamide |
| SMILES | COc1ccc(CNC2CCN(c3ccc(NC(=O)c4ccc(C)cc4C)cc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C29H35N3O3/c1-20-5-12-27(21(2)17-20)29(33)31-24-7-9-25(10-8-24)32-15-13-23(14-16-32)30-19-22-6-11-26(34-3)18-28(22)35-4/h5-12,17-18,23,30H,13-16,19H2,1-4H3,(H,31,33) |
| InChIKey | GDFGLZARIFLQHD-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|