C27H35N5O2 — CID 42473094
N-[4-[4-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methylamino]piperidin-1-yl]phenyl]-4-methoxybenzamide (PubChem CID 42473094) has the molecular formula C27H35N5O2 and a molecular weight of 461.61 g/mol. Its IUPAC name is N-[4-[4-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methylamino]piperidin-1-yl]phenyl]-4-methoxybenzamide.
| Compound Name | N-[4-[4-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methylamino]piperidin-1-yl]phenyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 42473094 |
| Molecular Formula | C27H35N5O2 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.28 |
| IUPAC Name | N-[4-[4-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methylamino]piperidin-1-yl]phenyl]-4-methoxybenzamide |
| SMILES | CCn1nc(C)c(CNC2CCN(c3ccc(NC(=O)c4ccc(OC)cc4)cc3)CC2)c1C |
| InChI | InChI=1S/C27H35N5O2/c1-5-32-20(3)26(19(2)30-32)18-28-22-14-16-31(17-15-22)24-10-8-23(9-11-24)29-27(33)21-6-12-25(34-4)13-7-21/h6-13,22,28H,5,14-18H2,1-4H3,(H,29,33) |
| InChIKey | PPZIFFAHVLTWBA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|