C28H31N5O2 — CID 42318665
N-[4-[4-[[(1R)-1-(1H-benzimidazol-2-yl)ethyl]amino]piperidin-1-yl]phenyl]-4-methoxybenzamide (PubChem CID 42318665) has the molecular formula C28H31N5O2 and a molecular weight of 469.59 g/mol. Its IUPAC name is N-[4-[4-[[(1R)-1-(1H-benzimidazol-2-yl)ethyl]amino]piperidin-1-yl]phenyl]-4-methoxybenzamide.
| Compound Name | N-[4-[4-[[(1R)-1-(1H-benzimidazol-2-yl)ethyl]amino]piperidin-1-yl]phenyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 42318665 |
| Molecular Formula | C28H31N5O2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | N-[4-[4-[[(1R)-1-(1H-benzimidazol-2-yl)ethyl]amino]piperidin-1-yl]phenyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(N3CCC(N[C@H](C)c4nc5ccccc5[nH]4)CC3)cc2)cc1 |
| InChI | InChI=1S/C28H31N5O2/c1-19(27-31-25-5-3-4-6-26(25)32-27)29-22-15-17-33(18-16-22)23-11-9-21(10-12-23)30-28(34)20-7-13-24(35-2)14-8-20/h3-14,19,22,29H,15-18H2,1-2H3,(H,30,34)(H,31,32)/t19-/m1/s1 |
| InChIKey | ZCUPUOMAWCATLQ-LJQANCHMSA-N |
| XLogP | 5.14 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|