C25H26F3N3O3 — CID 26400741
4-methoxy-N-[4-[4-[[(1R)-2,2,2-trifluoro-1-(furan-2-yl)ethyl]amino]piperidin-1-yl]phenyl]benzamide (PubChem CID 26400741) has the molecular formula C25H26F3N3O3 and a molecular weight of 473.50 g/mol. Its IUPAC name is 4-methoxy-N-[4-[4-[[(1R)-2,2,2-trifluoro-1-(furan-2-yl)ethyl]amino]piperidin-1-yl]phenyl]benzamide.
| Compound Name | 4-methoxy-N-[4-[4-[[(1R)-2,2,2-trifluoro-1-(furan-2-yl)ethyl]amino]piperidin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 26400741 |
| Molecular Formula | C25H26F3N3O3 |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 4-methoxy-N-[4-[4-[[(1R)-2,2,2-trifluoro-1-(furan-2-yl)ethyl]amino]piperidin-1-yl]phenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(N3CCC(N[C@H](c4ccco4)C(F)(F)F)CC3)cc2)cc1 |
| InChI | InChI=1S/C25H26F3N3O3/c1-33-21-10-4-17(5-11-21)24(32)30-18-6-8-20(9-7-18)31-14-12-19(13-15-31)29-23(25(26,27)28)22-3-2-16-34-22/h2-11,16,19,23,29H,12-15H2,1H3,(H,30,32)/t23-/m1/s1 |
| InChIKey | QNIFUNPDDDDPEG-HSZRJFAPSA-N |
| XLogP | 5.40 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|