C23H31N3O2 — CID 42434130
N-cyclopentyl-4-[4-[2-(furan-2-yl)ethylamino]piperidin-1-yl]benzamide (PubChem CID 42434130) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is N-cyclopentyl-4-[4-[2-(furan-2-yl)ethylamino]piperidin-1-yl]benzamide.
| Compound Name | N-cyclopentyl-4-[4-[2-(furan-2-yl)ethylamino]piperidin-1-yl]benzamide |
|---|---|
| PubChem CID | 42434130 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | N-cyclopentyl-4-[4-[2-(furan-2-yl)ethylamino]piperidin-1-yl]benzamide |
| SMILES | O=C(NC1CCCC1)c1ccc(N2CCC(NCCc3ccco3)CC2)cc1 |
| InChI | InChI=1S/C23H31N3O2/c27-23(25-20-4-1-2-5-20)18-7-9-21(10-8-18)26-15-12-19(13-16-26)24-14-11-22-6-3-17-28-22/h3,6-10,17,19-20,24H,1-2,4-5,11-16H2,(H,25,27) |
| InChIKey | PTTWVDHINWBMFJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |