C27H33N5O — CID 42485205
N-cyclopentyl-4-[4-[(4-pyrazol-1-ylphenyl)methylamino]piperidin-1-yl]benzamide (PubChem CID 42485205) has the molecular formula C27H33N5O and a molecular weight of 443.60 g/mol. Its IUPAC name is N-cyclopentyl-4-[4-[(4-pyrazol-1-ylphenyl)methylamino]piperidin-1-yl]benzamide.
| Compound Name | N-cyclopentyl-4-[4-[(4-pyrazol-1-ylphenyl)methylamino]piperidin-1-yl]benzamide |
|---|---|
| PubChem CID | 42485205 |
| Molecular Formula | C27H33N5O |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | N-cyclopentyl-4-[4-[(4-pyrazol-1-ylphenyl)methylamino]piperidin-1-yl]benzamide |
| SMILES | O=C(NC1CCCC1)c1ccc(N2CCC(NCc3ccc(-n4cccn4)cc3)CC2)cc1 |
| InChI | InChI=1S/C27H33N5O/c33-27(30-24-4-1-2-5-24)22-8-12-25(13-9-22)31-18-14-23(15-19-31)28-20-21-6-10-26(11-7-21)32-17-3-16-29-32/h3,6-13,16-17,23-24,28H,1-2,4-5,14-15,18-20H2,(H,30,33) |
| InChIKey | IRLRZFDMAJMGDJ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |