C27H36N4O — CID 26360963
N-cyclopentyl-4-[4-[(1-methyl-2,3-dihydroindol-5-yl)methylamino]piperidin-1-yl]benzamide (PubChem CID 26360963) has the molecular formula C27H36N4O and a molecular weight of 432.61 g/mol. Its IUPAC name is N-cyclopentyl-4-[4-[(1-methyl-2,3-dihydroindol-5-yl)methylamino]piperidin-1-yl]benzamide.
| Compound Name | N-cyclopentyl-4-[4-[(1-methyl-2,3-dihydroindol-5-yl)methylamino]piperidin-1-yl]benzamide |
|---|---|
| PubChem CID | 26360963 |
| Molecular Formula | C27H36N4O |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | N-cyclopentyl-4-[4-[(1-methyl-2,3-dihydroindol-5-yl)methylamino]piperidin-1-yl]benzamide |
| SMILES | CN1CCc2cc(CNC3CCN(c4ccc(C(=O)NC5CCCC5)cc4)CC3)ccc21 |
| InChI | InChI=1S/C27H36N4O/c1-30-15-12-22-18-20(6-11-26(22)30)19-28-23-13-16-31(17-14-23)25-9-7-21(8-10-25)27(32)29-24-4-2-3-5-24/h6-11,18,23-24,28H,2-5,12-17,19H2,1H3,(H,29,32) |
| InChIKey | DDRPJQIDLJYRCM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|