C19H25N5OS — CID 111940523
2-methyl-1-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-3-(thiophen-3-ylmethyl)guanidine (PubChem CID 111940523) has the molecular formula C19H25N5OS and a molecular weight of 371.51 g/mol. Its IUPAC name is 2-methyl-1-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-3-(thiophen-3-ylmethyl)guanidine.
| Compound Name | 2-methyl-1-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-3-(thiophen-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111940523 |
| Molecular Formula | C19H25N5OS |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 2-methyl-1-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-3-(thiophen-3-ylmethyl)guanidine |
| SMILES | C/N=C(/NCC(=O)N1CCN(c2ccccc2)CC1)NCc1ccsc1 |
| InChI | InChI=1S/C19H25N5OS/c1-20-19(21-13-16-7-12-26-15-16)22-14-18(25)24-10-8-23(9-11-24)17-5-3-2-4-6-17/h2-7,12,15H,8-11,13-14H2,1H3,(H2,20,21,22) |
| InChIKey | PFCNWUSXEDVIPF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|