C28H32ClN3O2 — CID 42167607
N-[4-[4-[2-(2-chlorophenyl)ethylamino]piperidin-1-yl]phenyl]-2-(4-methoxyphenyl)acetamide (PubChem CID 42167607) has the molecular formula C28H32ClN3O2 and a molecular weight of 478.04 g/mol. Its IUPAC name is N-[4-[4-[2-(2-chlorophenyl)ethylamino]piperidin-1-yl]phenyl]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[4-[4-[2-(2-chlorophenyl)ethylamino]piperidin-1-yl]phenyl]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 42167607 |
| Molecular Formula | C28H32ClN3O2 |
| Molecular Weight | 478.04 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | N-[4-[4-[2-(2-chlorophenyl)ethylamino]piperidin-1-yl]phenyl]-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)Nc2ccc(N3CCC(NCCc4ccccc4Cl)CC3)cc2)cc1 |
| InChI | InChI=1S/C28H32ClN3O2/c1-34-26-12-6-21(7-13-26)20-28(33)31-24-8-10-25(11-9-24)32-18-15-23(16-19-32)30-17-14-22-4-2-3-5-27(22)29/h2-13,23,30H,14-20H2,1H3,(H,31,33) |
| InChIKey | LYNRTSYPMQOGCS-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.04 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|