C24H31N3O3 — CID 45182245
2-(4-methoxyphenyl)-N-[4-[4-(oxolan-3-ylamino)piperidin-1-yl]phenyl]acetamide (PubChem CID 45182245) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-[4-[4-(oxolan-3-ylamino)piperidin-1-yl]phenyl]acetamide.
| Compound Name | 2-(4-methoxyphenyl)-N-[4-[4-(oxolan-3-ylamino)piperidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 45182245 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-[4-[4-(oxolan-3-ylamino)piperidin-1-yl]phenyl]acetamide |
| SMILES | COc1ccc(CC(=O)Nc2ccc(N3CCC(NC4CCOC4)CC3)cc2)cc1 |
| InChI | InChI=1S/C24H31N3O3/c1-29-23-8-2-18(3-9-23)16-24(28)26-19-4-6-22(7-5-19)27-13-10-20(11-14-27)25-21-12-15-30-17-21/h2-9,20-21,25H,10-17H2,1H3,(H,26,28) |
| InChIKey | LLESXLFXNOKPFI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|