C25H33N3O5S — CID 55500007
3-[(1,1-dioxothiolan-3-yl)-[(4-methoxyphenyl)methyl]amino]-N-(4-morpholin-4-ylphenyl)propanamide (PubChem CID 55500007) has the molecular formula C25H33N3O5S and a molecular weight of 487.62 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)-[(4-methoxyphenyl)methyl]amino]-N-(4-morpholin-4-ylphenyl)propanamide.
| Compound Name | 3-[(1,1-dioxothiolan-3-yl)-[(4-methoxyphenyl)methyl]amino]-N-(4-morpholin-4-ylphenyl)propanamide |
|---|---|
| PubChem CID | 55500007 |
| Molecular Formula | C25H33N3O5S |
| Molecular Weight | 487.62 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | 3-[(1,1-dioxothiolan-3-yl)-[(4-methoxyphenyl)methyl]amino]-N-(4-morpholin-4-ylphenyl)propanamide |
| SMILES | COc1ccc(CN(CCC(=O)Nc2ccc(N3CCOCC3)cc2)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C25H33N3O5S/c1-32-24-8-2-20(3-9-24)18-28(23-11-17-34(30,31)19-23)12-10-25(29)26-21-4-6-22(7-5-21)27-13-15-33-16-14-27/h2-9,23H,10-19H2,1H3,(H,26,29) |
| InChIKey | RQGZJSHQHVGRFV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.62 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|