C27H29ClN4O3 — CID 58258441
N-[4-[4-[2-amino-2-(2-chlorophenyl)acetyl]piperazin-1-yl]phenyl]-2-(4-methoxyphenyl)acetamide (PubChem CID 58258441) has the molecular formula C27H29ClN4O3 and a molecular weight of 493.01 g/mol. Its IUPAC name is N-[4-[4-[2-amino-2-(2-chlorophenyl)acetyl]piperazin-1-yl]phenyl]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[4-[4-[2-amino-2-(2-chlorophenyl)acetyl]piperazin-1-yl]phenyl]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 58258441 |
| Molecular Formula | C27H29ClN4O3 |
| Molecular Weight | 493.01 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | N-[4-[4-[2-amino-2-(2-chlorophenyl)acetyl]piperazin-1-yl]phenyl]-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)Nc2ccc(N3CCN(C(=O)C(N)c4ccccc4Cl)CC3)cc2)cc1 |
| InChI | InChI=1S/C27H29ClN4O3/c1-35-22-12-6-19(7-13-22)18-25(33)30-20-8-10-21(11-9-20)31-14-16-32(17-15-31)27(34)26(29)23-4-2-3-5-24(23)28/h2-13,26H,14-18,29H2,1H3,(H,30,33) |
| InChIKey | YPSUKFXIKVZWQK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.01 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|