C34H41Cl2N7O4 — CID 89128063
N-[4-[4-[N'-[2,6-dichloro-4-[4-(2-methoxyethyl)piperazine-1-carbonyl]phenyl]carbamimidoyl]piperazin-1-yl]phenyl]-2-(4-methoxyphenyl)acetamide (PubChem CID 89128063) has the molecular formula C34H41Cl2N7O4 and a molecular weight of 682.65 g/mol. Its IUPAC name is N-[4-[4-[N'-[2,6-dichloro-4-[4-(2-methoxyethyl)piperazine-1-carbonyl]phenyl]carbamimidoyl]piperazin-1-yl]phenyl]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[4-[4-[N'-[2,6-dichloro-4-[4-(2-methoxyethyl)piperazine-1-carbonyl]phenyl]carbamimidoyl]piperazin-1-yl]phenyl]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 89128063 |
| Molecular Formula | C34H41Cl2N7O4 |
| Molecular Weight | 682.65 g/mol |
| Exact Mass | 681.26 |
| IUPAC Name | N-[4-[4-[N'-[2,6-dichloro-4-[4-(2-methoxyethyl)piperazine-1-carbonyl]phenyl]carbamimidoyl]piperazin-1-yl]phenyl]-2-(4-methoxyphenyl)acetamide |
| SMILES | COCCN1CCN(C(=O)c2cc(Cl)c(/N=C(\N)N3CCN(c4ccc(NC(=O)Cc5ccc(OC)cc5)cc4)CC3)c(Cl)c2)CC1 |
| InChI | InChI=1S/C34H41Cl2N7O4/c1-46-20-19-40-11-13-42(14-12-40)33(45)25-22-29(35)32(30(36)23-25)39-34(37)43-17-15-41(16-18-43)27-7-5-26(6-8-27)38-31(44)21-24-3-9-28(47-2)10-4-24/h3-10,22-23H,11-21H2,1-2H3,(H2,37,39)(H,38,44) |
| InChIKey | JGZRTOADLUJTBQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.65 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|