C27H27Cl2N3O4 — CID 89219554
(2,6-dichloro-3-methylphenyl) 4-[4-[[2-(4-methoxyphenyl)acetyl]amino]phenyl]piperazine-1-carboxylate (PubChem CID 89219554) has the molecular formula C27H27Cl2N3O4 and a molecular weight of 528.44 g/mol. Its IUPAC name is (2,6-dichloro-3-methylphenyl) 4-[4-[[2-(4-methoxyphenyl)acetyl]amino]phenyl]piperazine-1-carboxylate.
| Compound Name | (2,6-dichloro-3-methylphenyl) 4-[4-[[2-(4-methoxyphenyl)acetyl]amino]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 89219554 |
| Molecular Formula | C27H27Cl2N3O4 |
| Molecular Weight | 528.44 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | (2,6-dichloro-3-methylphenyl) 4-[4-[[2-(4-methoxyphenyl)acetyl]amino]phenyl]piperazine-1-carboxylate |
| SMILES | COc1ccc(CC(=O)Nc2ccc(N3CCN(C(=O)Oc4c(Cl)ccc(C)c4Cl)CC3)cc2)cc1 |
| InChI | InChI=1S/C27H27Cl2N3O4/c1-18-3-12-23(28)26(25(18)29)36-27(34)32-15-13-31(14-16-32)21-8-6-20(7-9-21)30-24(33)17-19-4-10-22(35-2)11-5-19/h3-12H,13-17H2,1-2H3,(H,30,33) |
| InChIKey | QYCVVBVAQBDJAS-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.44 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|