C22H25FN2O4 — CID 42508020
N-[(4-fluorophenyl)methyl]-2-[1-(2-methoxyacetyl)piperidin-4-yl]oxybenzamide (PubChem CID 42508020) has the molecular formula C22H25FN2O4 and a molecular weight of 400.45 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-[1-(2-methoxyacetyl)piperidin-4-yl]oxybenzamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-[1-(2-methoxyacetyl)piperidin-4-yl]oxybenzamide |
|---|---|
| PubChem CID | 42508020 |
| Molecular Formula | C22H25FN2O4 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-[1-(2-methoxyacetyl)piperidin-4-yl]oxybenzamide |
| SMILES | COCC(=O)N1CCC(Oc2ccccc2C(=O)NCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H25FN2O4/c1-28-15-21(26)25-12-10-18(11-13-25)29-20-5-3-2-4-19(20)22(27)24-14-16-6-8-17(23)9-7-16/h2-9,18H,10-15H2,1H3,(H,24,27) |
| InChIKey | FKUJZLDCYQCOFR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |