C22H32N2O5 — CID 45186750
N-ethyl-2-[1-(2-methoxyacetyl)piperidin-4-yl]oxy-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 45186750) has the molecular formula C22H32N2O5 and a molecular weight of 404.51 g/mol. Its IUPAC name is N-ethyl-2-[1-(2-methoxyacetyl)piperidin-4-yl]oxy-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | N-ethyl-2-[1-(2-methoxyacetyl)piperidin-4-yl]oxy-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 45186750 |
| Molecular Formula | C22H32N2O5 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | N-ethyl-2-[1-(2-methoxyacetyl)piperidin-4-yl]oxy-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | CCN(CC1CCCO1)C(=O)c1ccccc1OC1CCN(C(=O)COC)CC1 |
| InChI | InChI=1S/C22H32N2O5/c1-3-23(15-18-7-6-14-28-18)22(26)19-8-4-5-9-20(19)29-17-10-12-24(13-11-17)21(25)16-27-2/h4-5,8-9,17-18H,3,6-7,10-16H2,1-2H3 |
| InChIKey | CFWMNNWZSGDXHH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |