C14H18ClFN2OS — CID 90630386
N-(2-chloroethyl)-7-(2-fluorophenyl)-1,4-thiazepane-4-carboxamide (PubChem CID 90630386) has the molecular formula C14H18ClFN2OS and a molecular weight of 316.83 g/mol. Its IUPAC name is N-(2-chloroethyl)-7-(2-fluorophenyl)-1,4-thiazepane-4-carboxamide.
| Compound Name | N-(2-chloroethyl)-7-(2-fluorophenyl)-1,4-thiazepane-4-carboxamide |
|---|---|
| PubChem CID | 90630386 |
| Molecular Formula | C14H18ClFN2OS |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | N-(2-chloroethyl)-7-(2-fluorophenyl)-1,4-thiazepane-4-carboxamide |
| SMILES | O=C(NCCCl)N1CCSC(c2ccccc2F)CC1 |
| InChI | InChI=1S/C14H18ClFN2OS/c15-6-7-17-14(19)18-8-5-13(20-10-9-18)11-3-1-2-4-12(11)16/h1-4,13H,5-10H2,(H,17,19) |
| InChIKey | DYSJBHFCSVTTRP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|