C18H17FINOS — CID 121163652
[7-(2-fluorophenyl)-1,4-thiazepan-4-yl]-(4-iodophenyl)methanone (PubChem CID 121163652) has the molecular formula C18H17FINOS and a molecular weight of 441.31 g/mol. Its IUPAC name is [7-(2-fluorophenyl)-1,4-thiazepan-4-yl]-(4-iodophenyl)methanone.
| Compound Name | [7-(2-fluorophenyl)-1,4-thiazepan-4-yl]-(4-iodophenyl)methanone |
|---|---|
| PubChem CID | 121163652 |
| Molecular Formula | C18H17FINOS |
| Molecular Weight | 441.31 g/mol |
| Exact Mass | 441.01 |
| IUPAC Name | [7-(2-fluorophenyl)-1,4-thiazepan-4-yl]-(4-iodophenyl)methanone |
| SMILES | O=C(c1ccc(I)cc1)N1CCSC(c2ccccc2F)CC1 |
| InChI | InChI=1S/C18H17FINOS/c19-16-4-2-1-3-15(16)17-9-10-21(11-12-23-17)18(22)13-5-7-14(20)8-6-13/h1-8,17H,9-12H2 |
| InChIKey | RPQCYRPUQFQBNX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.31 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|