C14H18Cl2N2OS — CID 3636809
N-tert-butyl-2-(2,3-dichlorophenyl)-1,3-thiazolidine-3-carboxamide (PubChem CID 3636809) has the molecular formula C14H18Cl2N2OS and a molecular weight of 333.28 g/mol. Its IUPAC name is N-tert-butyl-2-(2,3-dichlorophenyl)-1,3-thiazolidine-3-carboxamide.
| Compound Name | N-tert-butyl-2-(2,3-dichlorophenyl)-1,3-thiazolidine-3-carboxamide |
|---|---|
| PubChem CID | 3636809 |
| Molecular Formula | C14H18Cl2N2OS |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | N-tert-butyl-2-(2,3-dichlorophenyl)-1,3-thiazolidine-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)N1CCSC1c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H18Cl2N2OS/c1-14(2,3)17-13(19)18-7-8-20-12(18)9-5-4-6-10(15)11(9)16/h4-6,12H,7-8H2,1-3H3,(H,17,19) |
| InChIKey | WQVPHCFPFJGWOI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |