C17H24FNOS — CID 4163378
1-[2-(4-fluorophenyl)-1,3-thiazolidin-3-yl]octan-1-one (PubChem CID 4163378) has the molecular formula C17H24FNOS and a molecular weight of 309.45 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)-1,3-thiazolidin-3-yl]octan-1-one.
| Compound Name | 1-[2-(4-fluorophenyl)-1,3-thiazolidin-3-yl]octan-1-one |
|---|---|
| PubChem CID | 4163378 |
| Molecular Formula | C17H24FNOS |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 1-[2-(4-fluorophenyl)-1,3-thiazolidin-3-yl]octan-1-one |
| SMILES | CCCCCCCC(=O)N1CCSC1c1ccc(F)cc1 |
| InChI | InChI=1S/C17H24FNOS/c1-2-3-4-5-6-7-16(20)19-12-13-21-17(19)14-8-10-15(18)11-9-14/h8-11,17H,2-7,12-13H2,1H3 |
| InChIKey | ZSTCUGMMKBXQRQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|