C14H19FN2OS — CID 3359545
N-butyl-2-(4-fluorophenyl)-1,3-thiazolidine-3-carboxamide (PubChem CID 3359545) has the molecular formula C14H19FN2OS and a molecular weight of 282.38 g/mol. Its IUPAC name is N-butyl-2-(4-fluorophenyl)-1,3-thiazolidine-3-carboxamide.
| Compound Name | N-butyl-2-(4-fluorophenyl)-1,3-thiazolidine-3-carboxamide |
|---|---|
| PubChem CID | 3359545 |
| Molecular Formula | C14H19FN2OS |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | N-butyl-2-(4-fluorophenyl)-1,3-thiazolidine-3-carboxamide |
| SMILES | CCCCNC(=O)N1CCSC1c1ccc(F)cc1 |
| InChI | InChI=1S/C14H19FN2OS/c1-2-3-8-16-14(18)17-9-10-19-13(17)11-4-6-12(15)7-5-11/h4-7,13H,2-3,8-10H2,1H3,(H,16,18) |
| InChIKey | QXSCDZCWEIWLLG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|