C21H30FN3O2S — CID 93001954
(2S,5R)-N-butyl-2-(4-fluorophenyl)-5-(thiomorpholine-4-carbonyl)piperidine-1-carboxamide (PubChem CID 93001954) has the molecular formula C21H30FN3O2S and a molecular weight of 407.56 g/mol. Its IUPAC name is (2S,5R)-N-butyl-2-(4-fluorophenyl)-5-(thiomorpholine-4-carbonyl)piperidine-1-carboxamide.
| Compound Name | (2S,5R)-N-butyl-2-(4-fluorophenyl)-5-(thiomorpholine-4-carbonyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 93001954 |
| Molecular Formula | C21H30FN3O2S |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | (2S,5R)-N-butyl-2-(4-fluorophenyl)-5-(thiomorpholine-4-carbonyl)piperidine-1-carboxamide |
| SMILES | CCCCNC(=O)N1C[C@H](C(=O)N2CCSCC2)CC[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C21H30FN3O2S/c1-2-3-10-23-21(27)25-15-17(20(26)24-11-13-28-14-12-24)6-9-19(25)16-4-7-18(22)8-5-16/h4-5,7-8,17,19H,2-3,6,9-15H2,1H3,(H,23,27)/t17-,19+/m1/s1 |
| InChIKey | SRLAAINAYWCNQG-MJGOQNOKSA-N |
| XLogP | 3.66 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|