C25H32FN3O2 — CID 46041648
1-N-butyl-6-(4-fluorophenyl)-3-N-(1-phenylethyl)piperidine-1,3-dicarboxamide (PubChem CID 46041648) has the molecular formula C25H32FN3O2 and a molecular weight of 425.55 g/mol. Its IUPAC name is 1-N-butyl-6-(4-fluorophenyl)-3-N-(1-phenylethyl)piperidine-1,3-dicarboxamide.
| Compound Name | 1-N-butyl-6-(4-fluorophenyl)-3-N-(1-phenylethyl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 46041648 |
| Molecular Formula | C25H32FN3O2 |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | 1-N-butyl-6-(4-fluorophenyl)-3-N-(1-phenylethyl)piperidine-1,3-dicarboxamide |
| SMILES | CCCCNC(=O)N1CC(C(=O)NC(C)c2ccccc2)CCC1c1ccc(F)cc1 |
| InChI | InChI=1S/C25H32FN3O2/c1-3-4-16-27-25(31)29-17-21(12-15-23(29)20-10-13-22(26)14-11-20)24(30)28-18(2)19-8-6-5-7-9-19/h5-11,13-14,18,21,23H,3-4,12,15-17H2,1-2H3,(H,27,31)(H,28,30) |
| InChIKey | RYTWGYVPNQYVKC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|