C23H29FN4O2 — CID 46041651
1-N-butyl-6-(4-fluorophenyl)-3-N-(pyridin-3-ylmethyl)piperidine-1,3-dicarboxamide (PubChem CID 46041651) has the molecular formula C23H29FN4O2 and a molecular weight of 412.51 g/mol. Its IUPAC name is 1-N-butyl-6-(4-fluorophenyl)-3-N-(pyridin-3-ylmethyl)piperidine-1,3-dicarboxamide.
| Compound Name | 1-N-butyl-6-(4-fluorophenyl)-3-N-(pyridin-3-ylmethyl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 46041651 |
| Molecular Formula | C23H29FN4O2 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 1-N-butyl-6-(4-fluorophenyl)-3-N-(pyridin-3-ylmethyl)piperidine-1,3-dicarboxamide |
| SMILES | CCCCNC(=O)N1CC(C(=O)NCc2cccnc2)CCC1c1ccc(F)cc1 |
| InChI | InChI=1S/C23H29FN4O2/c1-2-3-13-26-23(30)28-16-19(22(29)27-15-17-5-4-12-25-14-17)8-11-21(28)18-6-9-20(24)10-7-18/h4-7,9-10,12,14,19,21H,2-3,8,11,13,15-16H2,1H3,(H,26,30)(H,27,29) |
| InChIKey | JQJFRFRXYVNQRL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|