C21H24FN3O3 — CID 46041524
6-(4-fluorophenyl)-1-(2-methoxyacetyl)-N-(pyridin-3-ylmethyl)piperidine-3-carboxamide (PubChem CID 46041524) has the molecular formula C21H24FN3O3 and a molecular weight of 385.44 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-1-(2-methoxyacetyl)-N-(pyridin-3-ylmethyl)piperidine-3-carboxamide.
| Compound Name | 6-(4-fluorophenyl)-1-(2-methoxyacetyl)-N-(pyridin-3-ylmethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 46041524 |
| Molecular Formula | C21H24FN3O3 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 6-(4-fluorophenyl)-1-(2-methoxyacetyl)-N-(pyridin-3-ylmethyl)piperidine-3-carboxamide |
| SMILES | COCC(=O)N1CC(C(=O)NCc2cccnc2)CCC1c1ccc(F)cc1 |
| InChI | InChI=1S/C21H24FN3O3/c1-28-14-20(26)25-13-17(21(27)24-12-15-3-2-10-23-11-15)6-9-19(25)16-4-7-18(22)8-5-16/h2-5,7-8,10-11,17,19H,6,9,12-14H2,1H3,(H,24,27) |
| InChIKey | NQXVPDNDDJRYGV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |