C25H33N3O2 — CID 93328595
(3S,6R)-3-N-benzyl-1-N-butyl-6-(3-methylphenyl)piperidine-1,3-dicarboxamide (PubChem CID 93328595) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is (3S,6R)-3-N-benzyl-1-N-butyl-6-(3-methylphenyl)piperidine-1,3-dicarboxamide.
| Compound Name | (3S,6R)-3-N-benzyl-1-N-butyl-6-(3-methylphenyl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 93328595 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | (3S,6R)-3-N-benzyl-1-N-butyl-6-(3-methylphenyl)piperidine-1,3-dicarboxamide |
| SMILES | CCCCNC(=O)N1C[C@@H](C(=O)NCc2ccccc2)CC[C@@H]1c1cccc(C)c1 |
| InChI | InChI=1S/C25H33N3O2/c1-3-4-15-26-25(30)28-18-22(24(29)27-17-20-10-6-5-7-11-20)13-14-23(28)21-12-8-9-19(2)16-21/h5-12,16,22-23H,3-4,13-15,17-18H2,1-2H3,(H,26,30)(H,27,29)/t22-,23+/m0/s1 |
| InChIKey | ZJHCQGMDGFLUBC-XZOQPEGZSA-N |
| XLogP | 4.57 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|