C26H33N3O4 — CID 42849662
3-N-(1,3-benzodioxol-5-ylmethyl)-1-N-butyl-6-(3-methylphenyl)piperidine-1,3-dicarboxamide (PubChem CID 42849662) has the molecular formula C26H33N3O4 and a molecular weight of 451.57 g/mol. Its IUPAC name is 3-N-(1,3-benzodioxol-5-ylmethyl)-1-N-butyl-6-(3-methylphenyl)piperidine-1,3-dicarboxamide.
| Compound Name | 3-N-(1,3-benzodioxol-5-ylmethyl)-1-N-butyl-6-(3-methylphenyl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 42849662 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | 3-N-(1,3-benzodioxol-5-ylmethyl)-1-N-butyl-6-(3-methylphenyl)piperidine-1,3-dicarboxamide |
| SMILES | CCCCNC(=O)N1CC(C(=O)NCc2ccc3c(c2)OCO3)CCC1c1cccc(C)c1 |
| InChI | InChI=1S/C26H33N3O4/c1-3-4-12-27-26(31)29-16-21(9-10-22(29)20-7-5-6-18(2)13-20)25(30)28-15-19-8-11-23-24(14-19)33-17-32-23/h5-8,11,13-14,21-22H,3-4,9-10,12,15-17H2,1-2H3,(H,27,31)(H,28,30) |
| InChIKey | OZHBJXIWVQQNEV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|