C20H29N3O4 — CID 52510139
(3R,6S)-1-N-(1,3-benzodioxol-5-ylmethyl)-3-N-butyl-6-methylpiperidine-1,3-dicarboxamide (PubChem CID 52510139) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is (3R,6S)-1-N-(1,3-benzodioxol-5-ylmethyl)-3-N-butyl-6-methylpiperidine-1,3-dicarboxamide.
| Compound Name | (3R,6S)-1-N-(1,3-benzodioxol-5-ylmethyl)-3-N-butyl-6-methylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 52510139 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | (3R,6S)-1-N-(1,3-benzodioxol-5-ylmethyl)-3-N-butyl-6-methylpiperidine-1,3-dicarboxamide |
| SMILES | CCCCNC(=O)[C@@H]1CC[C@H](C)N(C(=O)NCc2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C20H29N3O4/c1-3-4-9-21-19(24)16-7-5-14(2)23(12-16)20(25)22-11-15-6-8-17-18(10-15)27-13-26-17/h6,8,10,14,16H,3-5,7,9,11-13H2,1-2H3,(H,21,24)(H,22,25)/t14-,16+/m0/s1 |
| InChIKey | XZBQJRHFUSKNMC-GOEBONIOSA-N |
| XLogP | 2.64 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|