C26H39N3O4 — CID 46041682
ethyl 1-[1-(butylcarbamoyl)-6-(3-methylphenyl)piperidine-3-carbonyl]piperidine-3-carboxylate (PubChem CID 46041682) has the molecular formula C26H39N3O4 and a molecular weight of 457.62 g/mol. Its IUPAC name is ethyl 1-[1-(butylcarbamoyl)-6-(3-methylphenyl)piperidine-3-carbonyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[1-(butylcarbamoyl)-6-(3-methylphenyl)piperidine-3-carbonyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 46041682 |
| Molecular Formula | C26H39N3O4 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.29 |
| IUPAC Name | ethyl 1-[1-(butylcarbamoyl)-6-(3-methylphenyl)piperidine-3-carbonyl]piperidine-3-carboxylate |
| SMILES | CCCCNC(=O)N1CC(C(=O)N2CCCC(C(=O)OCC)C2)CCC1c1cccc(C)c1 |
| InChI | InChI=1S/C26H39N3O4/c1-4-6-14-27-26(32)29-18-21(12-13-23(29)20-10-7-9-19(3)16-20)24(30)28-15-8-11-22(17-28)25(31)33-5-2/h7,9-10,16,21-23H,4-6,8,11-15,17-18H2,1-3H3,(H,27,32) |
| InChIKey | BGUSLDGJCZWNKX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|