C24H35FN4O3 — CID 92997081
(2R,5R)-5-(4-acetylpiperazine-1-carbonyl)-N-butyl-2-(4-fluoro-3-methylphenyl)piperidine-1-carboxamide (PubChem CID 92997081) has the molecular formula C24H35FN4O3 and a molecular weight of 446.57 g/mol. Its IUPAC name is (2R,5R)-5-(4-acetylpiperazine-1-carbonyl)-N-butyl-2-(4-fluoro-3-methylphenyl)piperidine-1-carboxamide.
| Compound Name | (2R,5R)-5-(4-acetylpiperazine-1-carbonyl)-N-butyl-2-(4-fluoro-3-methylphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 92997081 |
| Molecular Formula | C24H35FN4O3 |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | (2R,5R)-5-(4-acetylpiperazine-1-carbonyl)-N-butyl-2-(4-fluoro-3-methylphenyl)piperidine-1-carboxamide |
| SMILES | CCCCNC(=O)N1C[C@H](C(=O)N2CCN(C(C)=O)CC2)CC[C@@H]1c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C24H35FN4O3/c1-4-5-10-26-24(32)29-16-20(23(31)28-13-11-27(12-14-28)18(3)30)7-9-22(29)19-6-8-21(25)17(2)15-19/h6,8,15,20,22H,4-5,7,9-14,16H2,1-3H3,(H,26,32)/t20-,22-/m1/s1 |
| InChIKey | TYRGQSIDDLMDDW-IFMALSPDSA-N |
| XLogP | 3.09 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|