C22H32FN3O2S — CID 46071987
N-butyl-2-(4-fluoro-3-methylphenyl)-5-(thiomorpholine-4-carbonyl)piperidine-1-carboxamide (PubChem CID 46071987) has the molecular formula C22H32FN3O2S and a molecular weight of 421.58 g/mol. Its IUPAC name is N-butyl-2-(4-fluoro-3-methylphenyl)-5-(thiomorpholine-4-carbonyl)piperidine-1-carboxamide.
| Compound Name | N-butyl-2-(4-fluoro-3-methylphenyl)-5-(thiomorpholine-4-carbonyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 46071987 |
| Molecular Formula | C22H32FN3O2S |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | N-butyl-2-(4-fluoro-3-methylphenyl)-5-(thiomorpholine-4-carbonyl)piperidine-1-carboxamide |
| SMILES | CCCCNC(=O)N1CC(C(=O)N2CCSCC2)CCC1c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C22H32FN3O2S/c1-3-4-9-24-22(28)26-15-18(21(27)25-10-12-29-13-11-25)6-8-20(26)17-5-7-19(23)16(2)14-17/h5,7,14,18,20H,3-4,6,8-13,15H2,1-2H3,(H,24,28) |
| InChIKey | HJFWVEFHRWUTFH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|