C21H30FN3O2 — CID 46067622
1-N-butyl-6-(4-fluoro-3-methylphenyl)-3-N-prop-2-enylpiperidine-1,3-dicarboxamide (PubChem CID 46067622) has the molecular formula C21H30FN3O2 and a molecular weight of 375.49 g/mol. Its IUPAC name is 1-N-butyl-6-(4-fluoro-3-methylphenyl)-3-N-prop-2-enylpiperidine-1,3-dicarboxamide.
| Compound Name | 1-N-butyl-6-(4-fluoro-3-methylphenyl)-3-N-prop-2-enylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 46067622 |
| Molecular Formula | C21H30FN3O2 |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 1-N-butyl-6-(4-fluoro-3-methylphenyl)-3-N-prop-2-enylpiperidine-1,3-dicarboxamide |
| SMILES | C=CCNC(=O)C1CCC(c2ccc(F)c(C)c2)N(C(=O)NCCCC)C1 |
| InChI | InChI=1S/C21H30FN3O2/c1-4-6-12-24-21(27)25-14-17(20(26)23-11-5-2)8-10-19(25)16-7-9-18(22)15(3)13-16/h5,7,9,13,17,19H,2,4,6,8,10-12,14H2,1,3H3,(H,23,26)(H,24,27) |
| InChIKey | PSGWJIBHZBXVER-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|