C24H31FN4O2 — CID 42866470
1-N-butyl-6-(4-fluoro-3-methylphenyl)-3-N-(pyridin-2-ylmethyl)piperidine-1,3-dicarboxamide (PubChem CID 42866470) has the molecular formula C24H31FN4O2 and a molecular weight of 426.54 g/mol. Its IUPAC name is 1-N-butyl-6-(4-fluoro-3-methylphenyl)-3-N-(pyridin-2-ylmethyl)piperidine-1,3-dicarboxamide.
| Compound Name | 1-N-butyl-6-(4-fluoro-3-methylphenyl)-3-N-(pyridin-2-ylmethyl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 42866470 |
| Molecular Formula | C24H31FN4O2 |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 1-N-butyl-6-(4-fluoro-3-methylphenyl)-3-N-(pyridin-2-ylmethyl)piperidine-1,3-dicarboxamide |
| SMILES | CCCCNC(=O)N1CC(C(=O)NCc2ccccn2)CCC1c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C24H31FN4O2/c1-3-4-12-27-24(31)29-16-19(23(30)28-15-20-7-5-6-13-26-20)9-11-22(29)18-8-10-21(25)17(2)14-18/h5-8,10,13-14,19,22H,3-4,9,11-12,15-16H2,1-2H3,(H,27,31)(H,28,30) |
| InChIKey | XEXZCZWBTGCWNJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|